C23H17N5O2S — CID 87381246
2-[3-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]pyrrol-1-yl]acetaldehyde (PubChem CID 87381246) has the molecular formula C23H17N5O2S and a molecular weight of 427.49 g/mol. Its IUPAC name is 2-[3-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]pyrrol-1-yl]acetaldehyde.
| Compound Name | 2-[3-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]pyrrol-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 87381246 |
| Molecular Formula | C23H17N5O2S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | 2-[3-[3-[4-(1,3-benzothiazol-2-ylamino)phenoxy]pyrazin-2-yl]pyrrol-1-yl]acetaldehyde |
| SMILES | O=CCn1ccc(-c2nccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)c1 |
| InChI | InChI=1S/C23H17N5O2S/c29-14-13-28-12-9-16(15-28)21-22(25-11-10-24-21)30-18-7-5-17(6-8-18)26-23-27-19-3-1-2-4-20(19)31-23/h1-12,14-15H,13H2,(H,26,27) |
| InChIKey | RUMSNJIKUZDGPR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|