C23H15ClN4OS — CID 59326991
N-[4-[[3-(6-chloro-3-pyridinyl)-2-pyridinyl]oxy]phenyl]-1,3-benzothiazol-2-amine (PubChem CID 59326991) has the molecular formula C23H15ClN4OS and a molecular weight of 430.92 g/mol. Its IUPAC name is N-[4-[[3-(6-chloro-3-pyridinyl)-2-pyridinyl]oxy]phenyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[4-[[3-(6-chloro-3-pyridinyl)-2-pyridinyl]oxy]phenyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 59326991 |
| Molecular Formula | C23H15ClN4OS |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.07 |
| IUPAC Name | N-[4-[[3-(6-chloro-3-pyridinyl)-2-pyridinyl]oxy]phenyl]-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc(-c2cccnc2Oc2ccc(Nc3nc4ccccc4s3)cc2)cn1 |
| InChI | InChI=1S/C23H15ClN4OS/c24-21-12-7-15(14-26-21)18-4-3-13-25-22(18)29-17-10-8-16(9-11-17)27-23-28-19-5-1-2-6-20(19)30-23/h1-14H,(H,27,28) |
| InChIKey | ZJLVYBVTJXOZNT-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|