C23H21N3O3 — CID 46214542
N-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]-1,3-benzoxazol-2-amine (PubChem CID 46214542) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]-1,3-benzoxazol-2-amine.
| Compound Name | N-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 46214542 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-[4-[[3-(oxan-4-yl)-2-pyridinyl]oxy]phenyl]-1,3-benzoxazol-2-amine |
| SMILES | c1cnc(Oc2ccc(Nc3nc4ccccc4o3)cc2)c(C2CCOCC2)c1 |
| InChI | InChI=1S/C23H21N3O3/c1-2-6-21-20(5-1)26-23(29-21)25-17-7-9-18(10-8-17)28-22-19(4-3-13-24-22)16-11-14-27-15-12-16/h1-10,13,16H,11-12,14-15H2,(H,25,26) |
| InChIKey | ORAWXJGNOQYIMP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |