C13H24O2S2 — CID 46215594
3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]butane-1,3-diol (PubChem CID 46215594) has the molecular formula C13H24O2S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is 3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]butane-1,3-diol.
| Compound Name | 3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]butane-1,3-diol |
|---|---|
| PubChem CID | 46215594 |
| Molecular Formula | C13H24O2S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 3-methyl-4-[2-(2-methylprop-1-enyl)-1,3-dithian-2-yl]butane-1,3-diol |
| SMILES | CC(C)=CC1(CC(C)(O)CCO)SCCCS1 |
| InChI | InChI=1S/C13H24O2S2/c1-11(2)9-13(16-7-4-8-17-13)10-12(3,15)5-6-14/h9,14-15H,4-8,10H2,1-3H3 |
| InChIKey | SQFZGRQIYZOHMU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|