C16H23IN2O3 — CID 46216872
methyl (2S)-3-(2-iodophenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoate (PubChem CID 46216872) has the molecular formula C16H23IN2O3 and a molecular weight of 418.28 g/mol. Its IUPAC name is methyl (2S)-3-(2-iodophenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-(2-iodophenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 46216872 |
| Molecular Formula | C16H23IN2O3 |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | methyl (2S)-3-(2-iodophenyl)-2-[[(2S)-3-methyl-2-(methylamino)butanoyl]amino]propanoate |
| SMILES | CN[C@H](C(=O)N[C@@H](Cc1ccccc1I)C(=O)OC)C(C)C |
| InChI | InChI=1S/C16H23IN2O3/c1-10(2)14(18-3)15(20)19-13(16(21)22-4)9-11-7-5-6-8-12(11)17/h5-8,10,13-14,18H,9H2,1-4H3,(H,19,20)/t13-,14-/m0/s1 |
| InChIKey | PCGVTHXTNGZIID-KBPBESRZSA-N |
| XLogP | 1.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|