C20H23F3N2O4 — CID 46218070
4-O-tert-butyl 1-O-prop-2-enyl (2R)-2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]butanedioate (PubChem CID 46218070) has the molecular formula C20H23F3N2O4 and a molecular weight of 412.41 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-prop-2-enyl (2R)-2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-prop-2-enyl (2R)-2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]butanedioate |
|---|---|
| PubChem CID | 46218070 |
| Molecular Formula | C20H23F3N2O4 |
| Molecular Weight | 412.41 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-O-tert-butyl 1-O-prop-2-enyl (2R)-2-[[4-[3-(trifluoromethyl)diazirin-3-yl]phenyl]methyl]butanedioate |
| SMILES | C=CCOC(=O)[C@@H](CC(=O)OC(C)(C)C)Cc1ccc(C2(C(F)(F)F)N=N2)cc1 |
| InChI | InChI=1S/C20H23F3N2O4/c1-5-10-28-17(27)14(12-16(26)29-18(2,3)4)11-13-6-8-15(9-7-13)19(24-25-19)20(21,22)23/h5-9,14H,1,10-12H2,2-4H3/t14-/m1/s1 |
| InChIKey | YSBQHPQGGGIEEN-CQSZACIVSA-N |
| XLogP | 4.49 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|