C14H30O4Si — CID 46218225
(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)hexanal (PubChem CID 46218225) has the molecular formula C14H30O4Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)hexanal.
| Compound Name | (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)hexanal |
|---|---|
| PubChem CID | 46218225 |
| Molecular Formula | C14H30O4Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)hexanal |
| SMILES | COCO[C@@H](CC=O)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30O4Si/c1-12(18-19(6,7)14(2,3)4)10-13(8-9-15)17-11-16-5/h9,12-13H,8,10-11H2,1-7H3/t12-,13-/m0/s1 |
| InChIKey | HTEYCRQETBDXHV-STQMWFEESA-N |
| XLogP | 3.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|