C22H46O4Si — CID 71479563
(3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)tetradecanal (PubChem CID 71479563) has the molecular formula C22H46O4Si and a molecular weight of 402.69 g/mol. Its IUPAC name is (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)tetradecanal.
| Compound Name | (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)tetradecanal |
|---|---|
| PubChem CID | 71479563 |
| Molecular Formula | C22H46O4Si |
| Molecular Weight | 402.69 g/mol |
| Exact Mass | 402.32 |
| IUPAC Name | (3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)tetradecanal |
| SMILES | CCCCCCCCC[C@@H](C[C@H](CC=O)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H46O4Si/c1-8-9-10-11-12-13-14-15-21(26-27(6,7)22(2,3)4)18-20(16-17-23)25-19-24-5/h17,20-21H,8-16,18-19H2,1-7H3/t20-,21-/m0/s1 |
| InChIKey | CTLVDTMHVMHITK-SFTDATJTSA-N |
| XLogP | 6.49 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.69 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|