C24H23ClN2O3 — CID 4622070
5-(4-butoxyphenyl)-9-chloro-2-(furan-2-yl)-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 4622070) has the molecular formula C24H23ClN2O3 and a molecular weight of 422.91 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-9-chloro-2-(furan-2-yl)-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | 5-(4-butoxyphenyl)-9-chloro-2-(furan-2-yl)-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 4622070 |
| Molecular Formula | C24H23ClN2O3 |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 5-(4-butoxyphenyl)-9-chloro-2-(furan-2-yl)-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | CCCCOc1ccc(C2Oc3ccc(Cl)cc3C3C=C(c4ccco4)NN32)cc1 |
| InChI | InChI=1S/C24H23ClN2O3/c1-2-3-12-28-18-9-6-16(7-10-18)24-27-21(15-20(26-27)23-5-4-13-29-23)19-14-17(25)8-11-22(19)30-24/h4-11,13-15,21,24,26H,2-3,12H2,1H3 |
| InChIKey | HUZQBOVJDQARDS-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|