C18H21NO4 — CID 46221328
[(1S)-2-methyl-1-[(5R)-4-oxo-2-phenyl-5-prop-2-enyl-1,3-oxazol-5-yl]propyl] acetate (PubChem CID 46221328) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is [(1S)-2-methyl-1-[(5R)-4-oxo-2-phenyl-5-prop-2-enyl-1,3-oxazol-5-yl]propyl] acetate.
| Compound Name | [(1S)-2-methyl-1-[(5R)-4-oxo-2-phenyl-5-prop-2-enyl-1,3-oxazol-5-yl]propyl] acetate |
|---|---|
| PubChem CID | 46221328 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | [(1S)-2-methyl-1-[(5R)-4-oxo-2-phenyl-5-prop-2-enyl-1,3-oxazol-5-yl]propyl] acetate |
| SMILES | C=CC[C@]1([C@@H](OC(C)=O)C(C)C)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C18H21NO4/c1-5-11-18(15(12(2)3)22-13(4)20)17(21)19-16(23-18)14-9-7-6-8-10-14/h5-10,12,15H,1,11H2,2-4H3/t15-,18+/m0/s1 |
| InChIKey | STEBCKALGXXYRI-MAUKXSAKSA-N |
| XLogP | 2.89 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|