C17H19NO2 — CID 11231005
(5R)-5-methyl-5-[(3S)-5-methylhexa-1,4-dien-3-yl]-2-phenyl-1,3-oxazol-4-one (PubChem CID 11231005) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is (5R)-5-methyl-5-[(3S)-5-methylhexa-1,4-dien-3-yl]-2-phenyl-1,3-oxazol-4-one.
| Compound Name | (5R)-5-methyl-5-[(3S)-5-methylhexa-1,4-dien-3-yl]-2-phenyl-1,3-oxazol-4-one |
|---|---|
| PubChem CID | 11231005 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | (5R)-5-methyl-5-[(3S)-5-methylhexa-1,4-dien-3-yl]-2-phenyl-1,3-oxazol-4-one |
| SMILES | C=C[C@@H](C=C(C)C)[C@@]1(C)OC(c2ccccc2)=NC1=O |
| InChI | InChI=1S/C17H19NO2/c1-5-14(11-12(2)3)17(4)16(19)18-15(20-17)13-9-7-6-8-10-13/h5-11,14H,1H2,2-4H3/t14-,17+/m0/s1 |
| InChIKey | HWOMIYQGESQZAQ-WMLDXEAASA-N |
| XLogP | 3.52 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|