C13H17N3 — CID 46222044
4-(2-(3,4-Dimethylphenylamino)ethyl)-1H-imidazole (PubChem CID 46222044) has the molecular formula C13H17N3 and a molecular weight of 215.29 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-3,4-dimethylaniline.
| Compound Name | 4-(2-(3,4-Dimethylphenylamino)ethyl)-1H-imidazole |
|---|---|
| PubChem CID | 46222044 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-3,4-dimethylaniline |
| SMILES | CC1=C(C=C(C=C1)NCCC2=CN=CN2)C |
| InChI | InChI=1S/C13H17N3/c1-10-3-4-12(7-11(10)2)15-6-5-13-8-14-9-16-13/h3-4,7-9,15H,5-6H2,1-2H3,(H,14,16) |
| InChIKey | GHCPLWBMALOXTM-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 40.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | 207 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |