About Atipamezole
Atipamezole (PubChem CID 71310) has the molecular formula C14H16N2
and a molecular weight of 212.29 g/mol. Its IUPAC name is 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole.
Molecular Properties
| Compound Name | Atipamezole |
| PubChem CID | 71310 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole |
| SMILES | CCC1(CC2=CC=CC=C2C1)C3=CN=CN3 |
| InChI | InChI=1S/C14H16N2/c1-2-14(13-9-15-10-16-13)7-11-5-3-4-6-12(11)8-14/h3-6,9-10H,2,7-8H2,1H3,(H,15,16) |
| InChIKey | HSWPZIDYAHLZDD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 28.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | 237 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Atipamezole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Atipamezole?
The IUPAC name of Atipamezole (CID 71310) is 5-(2-ethyl-1,3-dihydroinden-2-yl)-1H-imidazole.
What is the SMILES notation for Atipamezole?
The canonical SMILES for Atipamezole is CCC1(CC2=CC=CC=C2C1)C3=CN=CN3.
What is the InChIKey of Atipamezole?
The InChIKey is HSWPZIDYAHLZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2/c1-2-14(13-9-15-10-16-13)7-11-5-3-4-6-12(11)8-14/h3-6,9-10H,2,7-8H2,1H3,(H,15,16).
What are the key properties of Atipamezole?
Atipamezole has a molecular weight of 212.29 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Atipamezole is sourced from PubChem (CID 71310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).