C13H16BrNO2 — CID 46223673
(2R)-3-(4-methylquinolin-1-ium-1-yl)propane-1,2-diol bromide (PubChem CID 46223673) has the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. Its IUPAC name is (2R)-3-(4-methylquinolin-1-ium-1-yl)propane-1,2-diol bromide.
| Compound Name | (2R)-3-(4-methylquinolin-1-ium-1-yl)propane-1,2-diol bromide |
|---|---|
| PubChem CID | 46223673 |
| Molecular Formula | C13H16BrNO2 |
| Molecular Weight | 298.18 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (2R)-3-(4-methylquinolin-1-ium-1-yl)propane-1,2-diol bromide |
| SMILES | Cc1cc[n+](C[C@@H](O)CO)c2ccccc12.[Br-] |
| InChI | InChI=1S/C13H16NO2.BrH/c1-10-6-7-14(8-11(16)9-15)13-5-3-2-4-12(10)13;/h2-7,11,15-16H,8-9H2,1H3;1H/q+1;/p-1/t11-;/m1./s1 |
| InChIKey | XKNBMWSVFVZYHR-RFVHGSKJSA-M |
| XLogP | -2.21 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.18 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|