C21H23N3O — CID 46224759
3-amino-1-(6-methyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one (PubChem CID 46224759) has the molecular formula C21H23N3O and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-amino-1-(6-methyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one.
| Compound Name | 3-amino-1-(6-methyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
|---|---|
| PubChem CID | 46224759 |
| Molecular Formula | C21H23N3O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 3-amino-1-(6-methyl-1-phenyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)propan-1-one |
| SMILES | Cc1ccc2[nH]c3c(c2c1)CCN(C(=O)CCN)C3c1ccccc1 |
| InChI | InChI=1S/C21H23N3O/c1-14-7-8-18-17(13-14)16-10-12-24(19(25)9-11-22)21(20(16)23-18)15-5-3-2-4-6-15/h2-8,13,21,23H,9-12,22H2,1H3 |
| InChIKey | DJHNMCPRBYIBLB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|