C20H39NO — CID 46225451
(NE)-N-[(E)-3,7,11,15-tetramethylhexadec-2-enylidene]hydroxylamine (PubChem CID 46225451) has the molecular formula C20H39NO and a molecular weight of 309.54 g/mol. Its IUPAC name is (NE)-N-[(E)-3,7,11,15-tetramethylhexadec-2-enylidene]hydroxylamine.
| Compound Name | (NE)-N-[(E)-3,7,11,15-tetramethylhexadec-2-enylidene]hydroxylamine |
|---|---|
| PubChem CID | 46225451 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | (NE)-N-[(E)-3,7,11,15-tetramethylhexadec-2-enylidene]hydroxylamine |
| SMILES | C/C(=C\C=N\O)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C20H39NO/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-21-22/h15-19,22H,6-14H2,1-5H3/b20-15+,21-16+ |
| InChIKey | PCWLLZGPLJKUCP-YJKAXRSRSA-N |
| XLogP | 6.83 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|