C19H16N4O2S — CID 4622644
N-[1-[3-(thiophene-2-carbonylamino)phenyl]ethylideneamino]pyridine-2-carboxamide (PubChem CID 4622644) has the molecular formula C19H16N4O2S and a molecular weight of 364.43 g/mol. Its IUPAC name is N-[1-[3-(thiophene-2-carbonylamino)phenyl]ethylideneamino]pyridine-2-carboxamide.
| Compound Name | N-[1-[3-(thiophene-2-carbonylamino)phenyl]ethylideneamino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 4622644 |
| Molecular Formula | C19H16N4O2S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[1-[3-(thiophene-2-carbonylamino)phenyl]ethylideneamino]pyridine-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccccn1)c1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C19H16N4O2S/c1-13(22-23-18(24)16-8-2-3-10-20-16)14-6-4-7-15(12-14)21-19(25)17-9-5-11-26-17/h2-12H,1H3,(H,21,25)(H,23,24) |
| InChIKey | YBHBQGQGGRJOQI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|