C24H21N5O3S — CID 46226690
5-(4-ethylsulfonylphenoxy)-6-(imidazol-1-ylmethyl)-2-pyridin-2-yl-1H-benzimidazole (PubChem CID 46226690) has the molecular formula C24H21N5O3S and a molecular weight of 459.53 g/mol. Its IUPAC name is 5-(4-ethylsulfonylphenoxy)-6-(imidazol-1-ylmethyl)-2-pyridin-2-yl-1H-benzimidazole.
| Compound Name | 5-(4-ethylsulfonylphenoxy)-6-(imidazol-1-ylmethyl)-2-pyridin-2-yl-1H-benzimidazole |
|---|---|
| PubChem CID | 46226690 |
| Molecular Formula | C24H21N5O3S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 5-(4-ethylsulfonylphenoxy)-6-(imidazol-1-ylmethyl)-2-pyridin-2-yl-1H-benzimidazole |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc3nc(-c4ccccn4)[nH]c3cc2Cn2ccnc2)cc1 |
| InChI | InChI=1S/C24H21N5O3S/c1-2-33(30,31)19-8-6-18(7-9-19)32-23-14-22-21(13-17(23)15-29-12-11-25-16-29)27-24(28-22)20-5-3-4-10-26-20/h3-14,16H,2,15H2,1H3,(H,27,28) |
| InChIKey | PGZFLIGICKGSIH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |