C25H22N4O5S — CID 11562233
1-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 11562233) has the molecular formula C25H22N4O5S and a molecular weight of 490.54 g/mol. Its IUPAC name is 1-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11562233 |
| Molecular Formula | C25H22N4O5S |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 1-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc3nc(-c4ccccn4)[nH]c3cc2CN2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C25H22N4O5S/c1-2-35(32,33)18-8-6-17(7-9-18)34-22-14-21-20(27-25(28-21)19-5-3-4-12-26-19)13-16(22)15-29-23(30)10-11-24(29)31/h3-9,12-14H,2,10-11,15H2,1H3,(H,27,28) |
| InChIKey | KFQGCVGSHWAFGW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|