C25H24N4O5S — CID 46226734
4-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]morpholin-3-one (PubChem CID 46226734) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is 4-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]morpholin-3-one.
| Compound Name | 4-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]morpholin-3-one |
|---|---|
| PubChem CID | 46226734 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 4-[[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]methyl]morpholin-3-one |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc3nc(-c4ccccn4)[nH]c3cc2CN2CCOCC2=O)cc1 |
| InChI | InChI=1S/C25H24N4O5S/c1-2-35(31,32)19-8-6-18(7-9-19)34-23-14-22-21(27-25(28-22)20-5-3-4-10-26-20)13-17(23)15-29-11-12-33-16-24(29)30/h3-10,13-14H,2,11-12,15-16H2,1H3,(H,27,28) |
| InChIKey | XNKAUSLNTJUONY-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |