C24H24N4O5S — CID 86620339
2-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]-N-methoxy-N-methylacetamide (PubChem CID 86620339) has the molecular formula C24H24N4O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is 2-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 86620339 |
| Molecular Formula | C24H24N4O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | 2-[6-(4-ethylsulfonylphenoxy)-2-pyridin-2-yl-3H-benzimidazol-5-yl]-N-methoxy-N-methylacetamide |
| SMILES | CCS(=O)(=O)c1ccc(Oc2cc3nc(-c4ccccn4)[nH]c3cc2CC(=O)N(C)OC)cc1 |
| InChI | InChI=1S/C24H24N4O5S/c1-4-34(30,31)18-10-8-17(9-11-18)33-22-15-21-20(13-16(22)14-23(29)28(2)32-3)26-24(27-21)19-7-5-6-12-25-19/h5-13,15H,4,14H2,1-3H3,(H,26,27) |
| InChIKey | OQEOCVWMAXBRMQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|