C12H10N2 — CID 46228107
5-methylpyrrolo[2,3-c]quinoline (PubChem CID 46228107) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-methylpyrrolo[2,3-c]quinoline.
| Compound Name | 5-methylpyrrolo[2,3-c]quinoline |
|---|---|
| PubChem CID | 46228107 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5-methylpyrrolo[2,3-c]quinoline |
| SMILES | Cn1cc2nccc-2c2ccccc21 |
| InChI | InChI=1S/C12H10N2/c1-14-8-11-9(6-7-13-11)10-4-2-3-5-12(10)14/h2-8H,1H3 |
| InChIKey | QNMJVZJCKXNKJL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |