C12H10N2O — CID 12938679
3-(1-methylindol-3-yl)-1,2-oxazole (PubChem CID 12938679) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-1,2-oxazole.
| Compound Name | 3-(1-methylindol-3-yl)-1,2-oxazole |
|---|---|
| PubChem CID | 12938679 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 3-(1-methylindol-3-yl)-1,2-oxazole |
| SMILES | Cn1cc(-c2ccon2)c2ccccc21 |
| InChI | InChI=1S/C12H10N2O/c1-14-8-10(11-6-7-15-13-11)9-4-2-3-5-12(9)14/h2-8H,1H3 |
| InChIKey | OJEPUEMTYOQEMW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |