C10H20N2O3S — CID 46228176
1-(4-propylsulfonyl-1,4-diazepan-1-yl)ethanone (PubChem CID 46228176) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is 1-(4-propylsulfonyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 1-(4-propylsulfonyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 46228176 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-(4-propylsulfonyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CCCS(=O)(=O)N1CCCN(C(C)=O)CC1 |
| InChI | InChI=1S/C10H20N2O3S/c1-3-9-16(14,15)12-6-4-5-11(7-8-12)10(2)13/h3-9H2,1-2H3 |
| InChIKey | DPSSLFMRPBUJDQ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |