C9H18N2O3S — CID 53016289
1-(4-ethylsulfonyl-1,4-diazepan-1-yl)ethanone (PubChem CID 53016289) has the molecular formula C9H18N2O3S and a molecular weight of 234.32 g/mol. Its IUPAC name is 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)ethanone.
| Compound Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)ethanone |
|---|---|
| PubChem CID | 53016289 |
| Molecular Formula | C9H18N2O3S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-(4-ethylsulfonyl-1,4-diazepan-1-yl)ethanone |
| SMILES | CCS(=O)(=O)N1CCCN(C(C)=O)CC1 |
| InChI | InChI=1S/C9H18N2O3S/c1-3-15(13,14)11-6-4-5-10(7-8-11)9(2)12/h3-8H2,1-2H3 |
| InChIKey | FLIBRHUKVCWMHD-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |