C10H13N3OS2 — CID 4622826
4-amino-N,3-bis(prop-2-enyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide (PubChem CID 4622826) has the molecular formula C10H13N3OS2 and a molecular weight of 255.37 g/mol. Its IUPAC name is 4-amino-N,3-bis(prop-2-enyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N,3-bis(prop-2-enyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 4622826 |
| Molecular Formula | C10H13N3OS2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 4-amino-N,3-bis(prop-2-enyl)-2-sulfanylidene-1,3-thiazole-5-carboxamide |
| SMILES | C=CCNC(=O)c1sc(=S)n(CC=C)c1N |
| InChI | InChI=1S/C10H13N3OS2/c1-3-5-12-9(14)7-8(11)13(6-4-2)10(15)16-7/h3-4H,1-2,5-6,11H2,(H,12,14) |
| InChIKey | MXSWQKGOQLOQOE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiaz_ene_B(17)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|