C24H24FN5O — CID 46231555
(5S)-2-amino-5-(2,6-diethyl-4-pyridinyl)-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one (PubChem CID 46231555) has the molecular formula C24H24FN5O and a molecular weight of 417.49 g/mol. Its IUPAC name is (5S)-2-amino-5-(2,6-diethyl-4-pyridinyl)-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one.
| Compound Name | (5S)-2-amino-5-(2,6-diethyl-4-pyridinyl)-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
|---|---|
| PubChem CID | 46231555 |
| Molecular Formula | C24H24FN5O |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | (5S)-2-amino-5-(2,6-diethyl-4-pyridinyl)-5-[3-(2-fluoro-3-pyridinyl)phenyl]-3-methylimidazol-4-one |
| SMILES | CCc1cc([C@]2(c3cccc(-c4cccnc4F)c3)N=C(N)N(C)C2=O)cc(CC)n1 |
| InChI | InChI=1S/C24H24FN5O/c1-4-18-13-17(14-19(5-2)28-18)24(22(31)30(3)23(26)29-24)16-9-6-8-15(12-16)20-10-7-11-27-21(20)25/h6-14H,4-5H2,1-3H3,(H2,26,29)/t24-/m0/s1 |
| InChIKey | FWLPFLWMHMGKPS-DEOSSOPVSA-N |
| XLogP | 3.44 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|