C25H23ClF5N2NaO9 — CID 46232446
sodium (2R,4S,5R,6R)-5-acetamido-6-[(1S,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-4-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]oxane-2-carboxylate (PubChem CID 46232446) has the molecular formula C25H23ClF5N2NaO9 and a molecular weight of 648.90 g/mol. Its IUPAC name is sodium (2R,4S,5R,6R)-5-acetamido-6-[(1S,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-4-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]oxane-2-carboxylate.
| Compound Name | sodium (2R,4S,5R,6R)-5-acetamido-6-[(1S,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-4-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]oxane-2-carboxylate |
|---|---|
| PubChem CID | 46232446 |
| Molecular Formula | C25H23ClF5N2NaO9 |
| Molecular Weight | 648.90 g/mol |
| Exact Mass | 648.09 |
| IUPAC Name | sodium (2R,4S,5R,6R)-5-acetamido-6-[(1S,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-4-hydroxy-2-[(2,3,4,5,6-pentafluorophenyl)methoxy]oxane-2-carboxylate |
| SMILES | CC(=O)N[C@H]1[C@H]([C@@H](O)[C@H](O)CNC(=O)c2ccc(Cl)cc2)O[C@@](OCc2c(F)c(F)c(F)c(F)c2F)(C(=O)[O-])C[C@@H]1O.[Na+] |
| InChI | InChI=1S/C25H24ClF5N2O9.Na/c1-9(34)33-20-13(35)6-25(24(39)40,41-8-12-15(27)17(29)19(31)18(30)16(12)28)42-22(20)21(37)14(36)7-32-23(38)10-2-4-11(26)5-3-10;/h2-5,13-14,20-22,35-37H,6-8H2,1H3,(H,32,38)(H,33,34)(H,39,40);/q;+1/p-1/t13-,14+,20+,21-,22+,25+;/m0./s1 |
| InChIKey | YLEWMFZCDABEJQ-YMIMNWNHSA-M |
| XLogP | -3.19 |
| TPSA | 177.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.90 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|