C32H30ClF2N2NaO10 — CID 102041143
sodium N-[(2R,3R,4S,6R)-4-benzoyloxy-6-carboxy-2-[(1R,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-6-[(2,3-difluorophenyl)methoxy]oxan-3-yl]ethanimidate (PubChem CID 102041143) has the molecular formula C32H30ClF2N2NaO10 and a molecular weight of 699.04 g/mol. Its IUPAC name is sodium N-[(2R,3R,4S,6R)-4-benzoyloxy-6-carboxy-2-[(1R,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-6-[(2,3-difluorophenyl)methoxy]oxan-3-yl]ethanimidate.
| Compound Name | sodium N-[(2R,3R,4S,6R)-4-benzoyloxy-6-carboxy-2-[(1R,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-6-[(2,3-difluorophenyl)methoxy]oxan-3-yl]ethanimidate |
|---|---|
| PubChem CID | 102041143 |
| Molecular Formula | C32H30ClF2N2NaO10 |
| Molecular Weight | 699.04 g/mol |
| Exact Mass | 698.15 |
| IUPAC Name | sodium N-[(2R,3R,4S,6R)-4-benzoyloxy-6-carboxy-2-[(1R,2R)-3-[(4-chlorobenzoyl)amino]-1,2-dihydroxypropyl]-6-[(2,3-difluorophenyl)methoxy]oxan-3-yl]ethanimidate |
| SMILES | C/C([O-])=N\[C@H]1[C@H]([C@H](O)[C@H](O)CNC(=O)c2ccc(Cl)cc2)O[C@@](OCc2cccc(F)c2F)(C(=O)O)C[C@@H]1OC(=O)c1ccccc1.[Na+] |
| InChI | InChI=1S/C32H31ClF2N2O10.Na/c1-17(38)37-26-24(46-30(42)19-6-3-2-4-7-19)14-32(31(43)44,45-16-20-8-5-9-22(34)25(20)35)47-28(26)27(40)23(39)15-36-29(41)18-10-12-21(33)13-11-18;/h2-13,23-24,26-28,39-40H,14-16H2,1H3,(H,36,41)(H,37,38)(H,43,44);/q;+1/p-1/t23-,24+,26-,27-,28-,32-;/m1./s1 |
| InChIKey | TXSJBOWXPNTYMN-VDWFXYJWSA-M |
| XLogP | -0.77 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.04 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|