C17H18F6N2O — CID 46232872
1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(butylamino)ethanol (PubChem CID 46232872) has the molecular formula C17H18F6N2O and a molecular weight of 380.33 g/mol. Its IUPAC name is 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(butylamino)ethanol.
| Compound Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(butylamino)ethanol |
|---|---|
| PubChem CID | 46232872 |
| Molecular Formula | C17H18F6N2O |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-[2,8-bis(trifluoromethyl)quinolin-4-yl]-2-(butylamino)ethanol |
| SMILES | CCCCNCC(O)c1cc(C(F)(F)F)nc2c(C(F)(F)F)cccc12 |
| InChI | InChI=1S/C17H18F6N2O/c1-2-3-7-24-9-13(26)11-8-14(17(21,22)23)25-15-10(11)5-4-6-12(15)16(18,19)20/h4-6,8,13,24,26H,2-3,7,9H2,1H3 |
| InChIKey | FNAWEZUMHMJQKN-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|