C21H22N2O3 — CID 46233522
(9-ethenyl-9-hydroxyxanthen-3-yl)-(4-methylpiperazin-1-yl)methanone (PubChem CID 46233522) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is (9-ethenyl-9-hydroxyxanthen-3-yl)-(4-methylpiperazin-1-yl)methanone.
| Compound Name | (9-ethenyl-9-hydroxyxanthen-3-yl)-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 46233522 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (9-ethenyl-9-hydroxyxanthen-3-yl)-(4-methylpiperazin-1-yl)methanone |
| SMILES | C=CC1(O)c2ccccc2Oc2cc(C(=O)N3CCN(C)CC3)ccc21 |
| InChI | InChI=1S/C21H22N2O3/c1-3-21(25)16-6-4-5-7-18(16)26-19-14-15(8-9-17(19)21)20(24)23-12-10-22(2)11-13-23/h3-9,14,25H,1,10-13H2,2H3 |
| InChIKey | UJVYQSXGVVSQEY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|