spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid

C21H14O4 — CID 151870020

IUPACspiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)C1(OC2)c2ccccc2Oc2ccccc21
InChIInChI=1S/C21H14O4/c22-20(23)13-9-10-14-12-24-21(17(14)11-13)15-5-1-3-7-18(15)25-19-8-4-2-6-16(19)21/h1-11H,12H2,(H,22,23)
InChIKeySMMJHFROQOJAQK-UHFFFAOYSA-N
MW330.34 g/mol
LogP4.31
Rot. Bonds1

About spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid

spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid (PubChem CID 151870020) has the molecular formula C21H14O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid.

Molecular Properties

Compound Namespiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid
PubChem CID151870020
Molecular FormulaC21H14O4
Molecular Weight330.34 g/mol
Exact Mass330.09
IUPAC Namespiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid
SMILESO=C(O)c1ccc2c(c1)C1(OC2)c2ccccc2Oc2ccccc21
InChIInChI=1S/C21H14O4/c22-20(23)13-9-10-14-12-24-21(17(14)11-13)15-5-1-3-7-18(15)25-19-8-4-2-6-16(19)21/h1-11H,12H2,(H,22,23)
InChIKeySMMJHFROQOJAQK-UHFFFAOYSA-N
XLogP4.31
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.34
LogP ≤ 54.31
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
The IUPAC name of spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid (CID 151870020) is spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid.
What is the SMILES notation for spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
The canonical SMILES for spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid is O=C(O)c1ccc2c(c1)C1(OC2)c2ccccc2Oc2ccccc21.
What is the InChIKey of spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
The InChIKey is SMMJHFROQOJAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14O4/c22-20(23)13-9-10-14-12-24-21(17(14)11-13)15-5-1-3-7-18(15)25-19-8-4-2-6-16(19)21/h1-11H,12H2,(H,22,23).
What are the key properties of spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid?
spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid has a molecular weight of 330.34 g/mol, XLogP of 4.31, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid is sourced from PubChem (CID 151870020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).