C21H14O4 — CID 151870020
spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid (PubChem CID 151870020) has the molecular formula C21H14O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid.
| Compound Name | spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
|---|---|
| PubChem CID | 151870020 |
| Molecular Formula | C21H14O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | spiro[1H-2-benzofuran-3,9'-xanthene]-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C1(OC2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C21H14O4/c22-20(23)13-9-10-14-12-24-21(17(14)11-13)15-5-1-3-7-18(15)25-19-8-4-2-6-16(19)21/h1-11H,12H2,(H,22,23) |
| InChIKey | SMMJHFROQOJAQK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |