C24H20O3 — CID 171503176
1-[2-(9,9-dimethylxanthene-2-carbonyl)phenyl]ethanone (PubChem CID 171503176) has the molecular formula C24H20O3 and a molecular weight of 356.42 g/mol. Its IUPAC name is 1-[2-(9,9-dimethylxanthene-2-carbonyl)phenyl]ethanone.
| Compound Name | 1-[2-(9,9-dimethylxanthene-2-carbonyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171503176 |
| Molecular Formula | C24H20O3 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-[2-(9,9-dimethylxanthene-2-carbonyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1C(=O)c1ccc2c(c1)C(C)(C)c1ccccc1O2 |
| InChI | InChI=1S/C24H20O3/c1-15(25)17-8-4-5-9-18(17)23(26)16-12-13-22-20(14-16)24(2,3)19-10-6-7-11-21(19)27-22/h4-14H,1-3H3 |
| InChIKey | ZYSWRZVZKCRAEG-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |