C33H29OP — CID 175584517
9,9-dimethylxanthene;triphenylphosphane (PubChem CID 175584517) has the molecular formula C33H29OP and a molecular weight of 472.57 g/mol. Its IUPAC name is 9,9-dimethylxanthene;triphenylphosphane.
| Compound Name | 9,9-dimethylxanthene;triphenylphosphane |
|---|---|
| PubChem CID | 175584517 |
| Molecular Formula | C33H29OP |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 9,9-dimethylxanthene;triphenylphosphane |
| SMILES | CC1(C)c2ccccc2Oc2ccccc21.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C15H14O/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h1-15H;3-10H,1-2H3 |
| InChIKey | RVAXYOFSGXBETC-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|