About 9,9-dimethylxanthene;phenylphosphane
9,9-dimethylxanthene;phenylphosphane (PubChem CID 155388268) has the molecular formula C21H21OP
and a molecular weight of 320.37 g/mol. Its IUPAC name is 9,9-dimethylxanthene;phenylphosphane.
Molecular Properties
| Compound Name | 9,9-dimethylxanthene;phenylphosphane |
| PubChem CID | 155388268 |
| Molecular Formula | C21H21OP |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 9,9-dimethylxanthene;phenylphosphane |
| SMILES | CC1(C)c2ccccc2Oc2ccccc21.Pc1ccccc1 |
| InChI | InChI=1S/C15H14O.C6H7P/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15;7-6-4-2-1-3-5-6/h3-10H,1-2H3;1-5H,7H2 |
| InChIKey | CYWPQIVDNCORPJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 9,9-dimethylxanthene;phenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethylxanthene;phenylphosphane?
The IUPAC name of 9,9-dimethylxanthene;phenylphosphane (CID 155388268) is 9,9-dimethylxanthene;phenylphosphane.
What is the SMILES notation for 9,9-dimethylxanthene;phenylphosphane?
The canonical SMILES for 9,9-dimethylxanthene;phenylphosphane is CC1(C)c2ccccc2Oc2ccccc21.Pc1ccccc1.
What is the InChIKey of 9,9-dimethylxanthene;phenylphosphane?
The InChIKey is CYWPQIVDNCORPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O.C6H7P/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15;7-6-4-2-1-3-5-6/h3-10H,1-2H3;1-5H,7H2.
What are the key properties of 9,9-dimethylxanthene;phenylphosphane?
9,9-dimethylxanthene;phenylphosphane has a molecular weight of 320.37 g/mol, XLogP of 5.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethylxanthene;phenylphosphane is sourced from PubChem (CID 155388268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).