C21H21OP — CID 155388268
9,9-dimethylxanthene;phenylphosphane (PubChem CID 155388268) has the molecular formula C21H21OP and a molecular weight of 320.37 g/mol. Its IUPAC name is 9,9-dimethylxanthene;phenylphosphane.
| Compound Name | 9,9-dimethylxanthene;phenylphosphane |
|---|---|
| PubChem CID | 155388268 |
| Molecular Formula | C21H21OP |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 9,9-dimethylxanthene;phenylphosphane |
| SMILES | CC1(C)c2ccccc2Oc2ccccc21.Pc1ccccc1 |
| InChI | InChI=1S/C15H14O.C6H7P/c1-15(2)11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15;7-6-4-2-1-3-5-6/h3-10H,1-2H3;1-5H,7H2 |
| InChIKey | CYWPQIVDNCORPJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|