C19H21Cl2N7O3S — CID 46234132
2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylpiperidin-1-yl]-4-(2-methyl-1,2,4-triazol-3-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 46234132) has the molecular formula C19H21Cl2N7O3S and a molecular weight of 498.40 g/mol. Its IUPAC name is 2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylpiperidin-1-yl]-4-(2-methyl-1,2,4-triazol-3-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylpiperidin-1-yl]-4-(2-methyl-1,2,4-triazol-3-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 46234132 |
| Molecular Formula | C19H21Cl2N7O3S |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-[(3S,4R)-4-[(3,4-dichloro-5-methyl-1H-pyrrole-2-carbonyl)amino]-3-methylpiperidin-1-yl]-4-(2-methyl-1,2,4-triazol-3-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | Cc1[nH]c(C(=O)N[C@@H]2CCN(c3nc(-c4ncnn4C)c(C(=O)O)s3)C[C@@H]2C)c(Cl)c1Cl |
| InChI | InChI=1S/C19H21Cl2N7O3S/c1-8-6-28(5-4-10(8)25-17(29)13-12(21)11(20)9(2)24-13)19-26-14(15(32-19)18(30)31)16-22-7-23-27(16)3/h7-8,10,24H,4-6H2,1-3H3,(H,25,29)(H,30,31)/t8-,10+/m0/s1 |
| InChIKey | YNPJWZSWXXBGAE-WCBMZHEXSA-N |
| XLogP | 3.22 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |