C32H26N6O4S — CID 46236618
1-[4-[4-[1-(benzenesulfonyl)-2-formylpyrrolo[2,3-b]pyridin-4-yl]-1-ethylpyrazol-3-yl]phenyl]-3-phenylurea (PubChem CID 46236618) has the molecular formula C32H26N6O4S and a molecular weight of 590.67 g/mol. Its IUPAC name is 1-[4-[4-[1-(benzenesulfonyl)-2-formylpyrrolo[2,3-b]pyridin-4-yl]-1-ethylpyrazol-3-yl]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[4-[1-(benzenesulfonyl)-2-formylpyrrolo[2,3-b]pyridin-4-yl]-1-ethylpyrazol-3-yl]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 46236618 |
| Molecular Formula | C32H26N6O4S |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 1-[4-[4-[1-(benzenesulfonyl)-2-formylpyrrolo[2,3-b]pyridin-4-yl]-1-ethylpyrazol-3-yl]phenyl]-3-phenylurea |
| SMILES | CCn1cc(-c2ccnc3c2cc(C=O)n3S(=O)(=O)c2ccccc2)c(-c2ccc(NC(=O)Nc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C32H26N6O4S/c1-2-37-20-29(30(36-37)22-13-15-24(16-14-22)35-32(40)34-23-9-5-3-6-10-23)27-17-18-33-31-28(27)19-25(21-39)38(31)43(41,42)26-11-7-4-8-12-26/h3-21H,2H2,1H3,(H2,34,35,40) |
| InChIKey | SCWORIWIDQFGTL-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 127.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|