C11H5F2N3OS — CID 46236717
6-(2,6-difluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile (PubChem CID 46236717) has the molecular formula C11H5F2N3OS and a molecular weight of 265.24 g/mol. Its IUPAC name is 6-(2,6-difluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile.
| Compound Name | 6-(2,6-difluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 46236717 |
| Molecular Formula | C11H5F2N3OS |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 6-(2,6-difluorophenyl)-4-oxo-2-sulfanylidene-1H-pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(-c2c(F)cccc2F)[nH]c(=S)[nH]c1=O |
| InChI | InChI=1S/C11H5F2N3OS/c12-6-2-1-3-7(13)8(6)9-5(4-14)10(17)16-11(18)15-9/h1-3H,(H2,15,16,17,18) |
| InChIKey | RQLWUFMNLNWGOZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|