C21H18N4O3S2 — CID 46238023
2-[[(2Z)-2-cyano-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 46238023) has the molecular formula C21H18N4O3S2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 2-[[(2Z)-2-cyano-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-[[(2Z)-2-cyano-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 46238023 |
| Molecular Formula | C21H18N4O3S2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[[(2Z)-2-cyano-2-(4-oxo-3-phenyl-1,3-thiazolidin-2-ylidene)acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | N#C/C(C(=O)Nc1sc2c(c1C(N)=O)CCCC2)=C1/SCC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H18N4O3S2/c22-10-14(21-25(16(26)11-29-21)12-6-2-1-3-7-12)19(28)24-20-17(18(23)27)13-8-4-5-9-15(13)30-20/h1-3,6-7H,4-5,8-9,11H2,(H2,23,27)(H,24,28)/b21-14- |
| InChIKey | IXYVPXYJXLMONS-STZFKDTASA-N |
| XLogP | 3.18 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|