C30H27N3O3S2 — CID 53483317
ethyl 2-[[(2Z)-2-cyano-2-[4-(4-methylphenyl)-3-phenyl-1,3-thiazol-2-ylidene]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 53483317) has the molecular formula C30H27N3O3S2 and a molecular weight of 541.70 g/mol. Its IUPAC name is ethyl 2-[[(2Z)-2-cyano-2-[4-(4-methylphenyl)-3-phenyl-1,3-thiazol-2-ylidene]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2Z)-2-cyano-2-[4-(4-methylphenyl)-3-phenyl-1,3-thiazol-2-ylidene]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 53483317 |
| Molecular Formula | C30H27N3O3S2 |
| Molecular Weight | 541.70 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | ethyl 2-[[(2Z)-2-cyano-2-[4-(4-methylphenyl)-3-phenyl-1,3-thiazol-2-ylidene]acetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)/C(C#N)=C2\SC=C(c3ccc(C)cc3)N2c2ccccc2)sc2c1CCCC2 |
| InChI | InChI=1S/C30H27N3O3S2/c1-3-36-30(35)26-22-11-7-8-12-25(22)38-28(26)32-27(34)23(17-31)29-33(21-9-5-4-6-10-21)24(18-37-29)20-15-13-19(2)14-16-20/h4-6,9-10,13-16,18H,3,7-8,11-12H2,1-2H3,(H,32,34)/b29-23- |
| InChIKey | SPEYHUZYEKBPKT-FAJYDZGRSA-N |
| XLogP | 7.04 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.70 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|