C10H12N6O2S — CID 46238322
4-morpholin-4-yl-3-(4-oxidopyrazin-4-ium-2-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 46238322) has the molecular formula C10H12N6O2S and a molecular weight of 280.31 g/mol. Its IUPAC name is 4-morpholin-4-yl-3-(4-oxidopyrazin-4-ium-2-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-morpholin-4-yl-3-(4-oxidopyrazin-4-ium-2-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 46238322 |
| Molecular Formula | C10H12N6O2S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 4-morpholin-4-yl-3-(4-oxidopyrazin-4-ium-2-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | [O-][n+]1ccnc(-c2n[nH]c(=S)n2N2CCOCC2)c1 |
| InChI | InChI=1S/C10H12N6O2S/c17-15-2-1-11-8(7-15)9-12-13-10(19)16(9)14-3-5-18-6-4-14/h1-2,7H,3-6H2,(H,13,19) |
| InChIKey | LPZKDAMXXXCOKV-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|