C7H12N4O2S — CID 83019374
3-(hydroxymethyl)-4-morpholin-4-yl-1H-1,2,4-triazole-5-thione (PubChem CID 83019374) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 3-(hydroxymethyl)-4-morpholin-4-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-(hydroxymethyl)-4-morpholin-4-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 83019374 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 3-(hydroxymethyl)-4-morpholin-4-yl-1H-1,2,4-triazole-5-thione |
| SMILES | OCc1n[nH]c(=S)n1N1CCOCC1 |
| InChI | InChI=1S/C7H12N4O2S/c12-5-6-8-9-7(14)11(6)10-1-3-13-4-2-10/h12H,1-5H2,(H,9,14) |
| InChIKey | GYWDWPDYADPUET-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 66.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|