C22H19N3O2 — CID 46238580
1'-(5-nitroquinolin-8-yl)spiro[indene-1,4'-piperidine] (PubChem CID 46238580) has the molecular formula C22H19N3O2 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1'-(5-nitroquinolin-8-yl)spiro[indene-1,4'-piperidine].
| Compound Name | 1'-(5-nitroquinolin-8-yl)spiro[indene-1,4'-piperidine] |
|---|---|
| PubChem CID | 46238580 |
| Molecular Formula | C22H19N3O2 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 1'-(5-nitroquinolin-8-yl)spiro[indene-1,4'-piperidine] |
| SMILES | O=[N+]([O-])c1ccc(N2CCC3(C=Cc4ccccc43)CC2)c2ncccc12 |
| InChI | InChI=1S/C22H19N3O2/c26-25(27)19-7-8-20(21-17(19)5-3-13-23-21)24-14-11-22(12-15-24)10-9-16-4-1-2-6-18(16)22/h1-10,13H,11-12,14-15H2 |
| InChIKey | IKFDEZSFSVTARU-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|