C18H20F3N3 — CID 46238981
N-(4-methylcyclohexyl)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 46238981) has the molecular formula C18H20F3N3 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-(4-methylcyclohexyl)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | N-(4-methylcyclohexyl)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 46238981 |
| Molecular Formula | C18H20F3N3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-(4-methylcyclohexyl)-5-[4-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | CC1CCC(Nc2ncc(-c3ccc(C(F)(F)F)cc3)cn2)CC1 |
| InChI | InChI=1S/C18H20F3N3/c1-12-2-8-16(9-3-12)24-17-22-10-14(11-23-17)13-4-6-15(7-5-13)18(19,20)21/h4-7,10-12,16H,2-3,8-9H2,1H3,(H,22,23,24) |
| InChIKey | ZAKSVAGGZDPSQA-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |