C36H48N4O6 — CID 46239036
[5-[(E)-3-[(3E)-3-[[3-(2-amino-3-methylbutanoyl)oxy-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2-amino-3-methylbutanoate (PubChem CID 46239036) has the molecular formula C36H48N4O6 and a molecular weight of 632.80 g/mol. Its IUPAC name is [5-[(E)-3-[(3E)-3-[[3-(2-amino-3-methylbutanoyl)oxy-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2-amino-3-methylbutanoate.
| Compound Name | [5-[(E)-3-[(3E)-3-[[3-(2-amino-3-methylbutanoyl)oxy-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 46239036 |
| Molecular Formula | C36H48N4O6 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | [5-[(E)-3-[(3E)-3-[[3-(2-amino-3-methylbutanoyl)oxy-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)Oc1cc(/C=C/C(=O)C2CCC/C(=C\c3ccc(N(C)C)c(OC(=O)C(N)C(C)C)c3)C2=O)ccc1N(C)C |
| InChI | InChI=1S/C36H48N4O6/c1-21(2)32(37)35(43)45-30-19-23(12-15-27(30)39(5)6)14-17-29(41)26-11-9-10-25(34(26)42)18-24-13-16-28(40(7)8)31(20-24)46-36(44)33(38)22(3)4/h12-22,26,32-33H,9-11,37-38H2,1-8H3/b17-14+,25-18+ |
| InChIKey | QVNICRQCTOMSEI-BTARTIJZSA-N |
| XLogP | 4.63 |
| TPSA | 145.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|