C38H54N6O6 — CID 66742188
[5-[3-[3-[[3-(2,6-diaminohexanoyloxy)-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2,6-diaminohexanoate (PubChem CID 66742188) has the molecular formula C38H54N6O6 and a molecular weight of 690.89 g/mol. Its IUPAC name is [5-[3-[3-[[3-(2,6-diaminohexanoyloxy)-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2,6-diaminohexanoate.
| Compound Name | [5-[3-[3-[[3-(2,6-diaminohexanoyloxy)-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2,6-diaminohexanoate |
|---|---|
| PubChem CID | 66742188 |
| Molecular Formula | C38H54N6O6 |
| Molecular Weight | 690.89 g/mol |
| Exact Mass | 690.41 |
| IUPAC Name | [5-[3-[3-[[3-(2,6-diaminohexanoyloxy)-4-(dimethylamino)phenyl]methylidene]-2-oxocyclohexyl]-3-oxoprop-1-enyl]-2-(dimethylamino)phenyl] 2,6-diaminohexanoate |
| SMILES | CN(C)c1ccc(C=CC(=O)C2CCCC(=Cc3ccc(N(C)C)c(OC(=O)C(N)CCCCN)c3)C2=O)cc1OC(=O)C(N)CCCCN |
| InChI | InChI=1S/C38H54N6O6/c1-43(2)31-17-14-25(23-34(31)49-37(47)29(41)12-5-7-20-39)16-19-33(45)28-11-9-10-27(36(28)46)22-26-15-18-32(44(3)4)35(24-26)50-38(48)30(42)13-6-8-21-40/h14-19,22-24,28-30H,5-13,20-21,39-42H2,1-4H3 |
| InChIKey | UQQGJKBZAIKJMF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 197.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.89 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|