C32H33NO4 — CID 46239422
ethyl 4-[[5-(6-methoxynaphthalen-2-yl)-1-(3-methylphenyl)-3-oxopentyl]amino]benzoate (PubChem CID 46239422) has the molecular formula C32H33NO4 and a molecular weight of 495.62 g/mol. Its IUPAC name is ethyl 4-[[5-(6-methoxynaphthalen-2-yl)-1-(3-methylphenyl)-3-oxopentyl]amino]benzoate.
| Compound Name | ethyl 4-[[5-(6-methoxynaphthalen-2-yl)-1-(3-methylphenyl)-3-oxopentyl]amino]benzoate |
|---|---|
| PubChem CID | 46239422 |
| Molecular Formula | C32H33NO4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | ethyl 4-[[5-(6-methoxynaphthalen-2-yl)-1-(3-methylphenyl)-3-oxopentyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(CC(=O)CCc2ccc3cc(OC)ccc3c2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C32H33NO4/c1-4-37-32(35)24-11-14-28(15-12-24)33-31(27-7-5-6-22(2)18-27)21-29(34)16-9-23-8-10-26-20-30(36-3)17-13-25(26)19-23/h5-8,10-15,17-20,31,33H,4,9,16,21H2,1-3H3 |
| InChIKey | HVOMASMRJZJERN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |