C21H18Cl2O2 — CID 46240339
(3Z)-3-[(2,4-dichlorophenyl)methylidene]-5-[4-(2-methylpropyl)phenyl]furan-2-one (PubChem CID 46240339) has the molecular formula C21H18Cl2O2 and a molecular weight of 373.28 g/mol. Its IUPAC name is (3Z)-3-[(2,4-dichlorophenyl)methylidene]-5-[4-(2-methylpropyl)phenyl]furan-2-one.
| Compound Name | (3Z)-3-[(2,4-dichlorophenyl)methylidene]-5-[4-(2-methylpropyl)phenyl]furan-2-one |
|---|---|
| PubChem CID | 46240339 |
| Molecular Formula | C21H18Cl2O2 |
| Molecular Weight | 373.28 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | (3Z)-3-[(2,4-dichlorophenyl)methylidene]-5-[4-(2-methylpropyl)phenyl]furan-2-one |
| SMILES | CC(C)Cc1ccc(C2=C/C(=C/c3ccc(Cl)cc3Cl)C(=O)O2)cc1 |
| InChI | InChI=1S/C21H18Cl2O2/c1-13(2)9-14-3-5-15(6-4-14)20-11-17(21(24)25-20)10-16-7-8-18(22)12-19(16)23/h3-8,10-13H,9H2,1-2H3/b17-10- |
| InChIKey | ZKLAGEHVLPQVLD-YVLHZVERSA-N |
| XLogP | 6.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.28 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|