C43H48ClN5O3 — CID 46241210
3-[3-[3-[[4-[4-[[2-(4-chlorophenyl)-5,5-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]methyl]-2-iminobenzimidazol-1-yl]propoxy]benzoic acid (PubChem CID 46241210) has the molecular formula C43H48ClN5O3 and a molecular weight of 718.34 g/mol. Its IUPAC name is 3-[3-[3-[[4-[4-[[2-(4-chlorophenyl)-5,5-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]methyl]-2-iminobenzimidazol-1-yl]propoxy]benzoic acid.
| Compound Name | 3-[3-[3-[[4-[4-[[2-(4-chlorophenyl)-5,5-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]methyl]-2-iminobenzimidazol-1-yl]propoxy]benzoic acid |
|---|---|
| PubChem CID | 46241210 |
| Molecular Formula | C43H48ClN5O3 |
| Molecular Weight | 718.34 g/mol |
| Exact Mass | 717.34 |
| IUPAC Name | 3-[3-[3-[[4-[4-[[2-(4-chlorophenyl)-5,5-dimethylcyclohexen-1-yl]methyl]piperazin-1-yl]phenyl]methyl]-2-iminobenzimidazol-1-yl]propoxy]benzoic acid |
| SMILES | [H]/N=c1\n(CCCOc2cccc(C(=O)O)c2)c2ccccc2n1Cc1ccc(N2CCN(CC3=C(c4ccc(Cl)cc4)CCC(C)(C)C3)CC2)cc1 |
| InChI | InChI=1S/C43H48ClN5O3/c1-43(2)20-19-38(32-13-15-35(44)16-14-32)34(28-43)30-46-22-24-47(25-23-46)36-17-11-31(12-18-36)29-49-40-10-4-3-9-39(40)48(42(49)45)21-6-26-52-37-8-5-7-33(27-37)41(50)51/h3-5,7-18,27,45H,6,19-26,28-30H2,1-2H3,(H,50,51)/b45-42+ |
| InChIKey | SBMCULILBTWNSL-NYHNVNJYSA-N |
| XLogP | 8.58 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.34 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|