C30H19BF2N4OS2 — CID 46242125
2-[12-(1,3-benzothiazol-2-yl)-2,2-difluoro-8-(4-methoxyphenyl)-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]-1,3-benzothiazole (PubChem CID 46242125) has the molecular formula C30H19BF2N4OS2 and a molecular weight of 564.45 g/mol. Its IUPAC name is 2-[12-(1,3-benzothiazol-2-yl)-2,2-difluoro-8-(4-methoxyphenyl)-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]-1,3-benzothiazole.
| Compound Name | 2-[12-(1,3-benzothiazol-2-yl)-2,2-difluoro-8-(4-methoxyphenyl)-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 46242125 |
| Molecular Formula | C30H19BF2N4OS2 |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 564.11 |
| IUPAC Name | 2-[12-(1,3-benzothiazol-2-yl)-2,2-difluoro-8-(4-methoxyphenyl)-1-aza-3-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-3,5,7,9,11-pentaen-4-yl]-1,3-benzothiazole |
| SMILES | COc1ccc(C2=C3C=CC(c4nc5ccccc5s4)=[N+]3[B-](F)(F)n3c2ccc3-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C30H19BF2N4OS2/c1-38-19-12-10-18(11-13-19)28-22-14-16-24(29-34-20-6-2-4-8-26(20)39-29)36(22)31(32,33)37-23(28)15-17-25(37)30-35-21-7-3-5-9-27(21)40-30/h2-17H,1H3 |
| InChIKey | NEFGSPROEZARMN-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 42.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|